C21H16ClN5O3 — CID 91564104
N'-[2-(4-chloro-5-cyanoindol-1-yl)-3-hydroxybutanoyl]-4-cyanobenzohydrazide (PubChem CID 91564104) has the molecular formula C21H16ClN5O3 and a molecular weight of 421.84 g/mol. Its IUPAC name is N'-[2-(4-chloro-5-cyanoindol-1-yl)-3-hydroxybutanoyl]-4-cyanobenzohydrazide.
| Compound Name | N'-[2-(4-chloro-5-cyanoindol-1-yl)-3-hydroxybutanoyl]-4-cyanobenzohydrazide |
|---|---|
| PubChem CID | 91564104 |
| Molecular Formula | C21H16ClN5O3 |
| Molecular Weight | 421.84 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | N'-[2-(4-chloro-5-cyanoindol-1-yl)-3-hydroxybutanoyl]-4-cyanobenzohydrazide |
| SMILES | CC(O)C(C(=O)NNC(=O)c1ccc(C#N)cc1)n1ccc2c(Cl)c(C#N)ccc21 |
| InChI | InChI=1S/C21H16ClN5O3/c1-12(28)19(27-9-8-16-17(27)7-6-15(11-24)18(16)22)21(30)26-25-20(29)14-4-2-13(10-23)3-5-14/h2-9,12,19,28H,1H3,(H,25,29)(H,26,30) |
| InChIKey | XKNITGQJRXCKJH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 130.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.84 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|