C19H16IN5O3 — CID 70671857
4-cyano-N'-[2-(4-cyano-3-iodo-2-methylanilino)-3-hydroxypropanoyl]benzohydrazide (PubChem CID 70671857) has the molecular formula C19H16IN5O3 and a molecular weight of 489.27 g/mol. Its IUPAC name is 4-cyano-N'-[2-(4-cyano-3-iodo-2-methylanilino)-3-hydroxypropanoyl]benzohydrazide.
| Compound Name | 4-cyano-N'-[2-(4-cyano-3-iodo-2-methylanilino)-3-hydroxypropanoyl]benzohydrazide |
|---|---|
| PubChem CID | 70671857 |
| Molecular Formula | C19H16IN5O3 |
| Molecular Weight | 489.27 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | 4-cyano-N'-[2-(4-cyano-3-iodo-2-methylanilino)-3-hydroxypropanoyl]benzohydrazide |
| SMILES | Cc1c(NC(CO)C(=O)NNC(=O)c2ccc(C#N)cc2)ccc(C#N)c1I |
| InChI | InChI=1S/C19H16IN5O3/c1-11-15(7-6-14(9-22)17(11)20)23-16(10-26)19(28)25-24-18(27)13-4-2-12(8-21)3-5-13/h2-7,16,23,26H,10H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | IMIUHQZZJLWJDY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 138.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|