C19H18ClN5O4 — CID 88908450
N'-[(3S)-2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]-4-nitrosobenzohydrazide (PubChem CID 88908450) has the molecular formula C19H18ClN5O4 and a molecular weight of 415.84 g/mol. Its IUPAC name is N'-[(3S)-2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]-4-nitrosobenzohydrazide.
| Compound Name | N'-[(3S)-2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]-4-nitrosobenzohydrazide |
|---|---|
| PubChem CID | 88908450 |
| Molecular Formula | C19H18ClN5O4 |
| Molecular Weight | 415.84 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | N'-[(3S)-2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]-4-nitrosobenzohydrazide |
| SMILES | Cc1c(NC(C(=O)NNC(=O)c2ccc(N=O)cc2)[C@H](C)O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C19H18ClN5O4/c1-10-15(8-5-13(9-21)16(10)20)22-17(11(2)26)19(28)24-23-18(27)12-3-6-14(25-29)7-4-12/h3-8,11,17,22,26H,1-2H3,(H,23,27)(H,24,28)/t11-,17?/m0/s1 |
| InChIKey | UTYKLOJCNFHXTK-PIJUOJQZSA-N |
| XLogP | 2.54 |
| TPSA | 143.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.84 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|