C20H21ClN4O5S — CID 77166003
N-[2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]-4-methylsulfonylbenzohydrazide (PubChem CID 77166003) has the molecular formula C20H21ClN4O5S and a molecular weight of 464.93 g/mol. Its IUPAC name is N-[2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]-4-methylsulfonylbenzohydrazide.
| Compound Name | N-[2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]-4-methylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 77166003 |
| Molecular Formula | C20H21ClN4O5S |
| Molecular Weight | 464.93 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | N-[2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]-4-methylsulfonylbenzohydrazide |
| SMILES | Cc1c(NC(C(=O)N(N)C(=O)c2ccc(S(C)(=O)=O)cc2)C(C)O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C20H21ClN4O5S/c1-11-16(9-6-14(10-22)17(11)21)24-18(12(2)26)20(28)25(23)19(27)13-4-7-15(8-5-13)31(3,29)30/h4-9,12,18,24,26H,23H2,1-3H3 |
| InChIKey | GPRFVAAXGDRCCE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 153.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.93 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|