C21H23ClN4O3 — CID 89160891
1-[4-(hydroxymethyl)phenyl]ethenyl (1Z,3S)-2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanehydrazonate (PubChem CID 89160891) has the molecular formula C21H23ClN4O3 and a molecular weight of 414.89 g/mol. Its IUPAC name is 1-[4-(hydroxymethyl)phenyl]ethenyl (1Z,3S)-2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanehydrazonate.
| Compound Name | 1-[4-(hydroxymethyl)phenyl]ethenyl (1Z,3S)-2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanehydrazonate |
|---|---|
| PubChem CID | 89160891 |
| Molecular Formula | C21H23ClN4O3 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 1-[4-(hydroxymethyl)phenyl]ethenyl (1Z,3S)-2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanehydrazonate |
| SMILES | C=C(O/C(=N\N)C(Nc1ccc(C#N)c(Cl)c1C)[C@H](C)O)c1ccc(CO)cc1 |
| InChI | InChI=1S/C21H23ClN4O3/c1-12-18(9-8-17(10-23)19(12)22)25-20(13(2)28)21(26-24)29-14(3)16-6-4-15(11-27)5-7-16/h4-9,13,20,25,27-28H,3,11,24H2,1-2H3/b26-21-/t13-,20?/m0/s1 |
| InChIKey | RLTNZAVFXDZALT-JGLCPZMRSA-N |
| XLogP | 3.13 |
| TPSA | 123.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|