C19H18Cl2N4O3 — CID 67006524
3-chloro-N'-[(2R,3S)-2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]benzohydrazide (PubChem CID 67006524) has the molecular formula C19H18Cl2N4O3 and a molecular weight of 421.28 g/mol. Its IUPAC name is 3-chloro-N'-[(2R,3S)-2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]benzohydrazide.
| Compound Name | 3-chloro-N'-[(2R,3S)-2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]benzohydrazide |
|---|---|
| PubChem CID | 67006524 |
| Molecular Formula | C19H18Cl2N4O3 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 3-chloro-N'-[(2R,3S)-2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]benzohydrazide |
| SMILES | Cc1c(N[C@@H](C(=O)NNC(=O)c2cccc(Cl)c2)[C@H](C)O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C19H18Cl2N4O3/c1-10-15(7-6-13(9-22)16(10)21)23-17(11(2)26)19(28)25-24-18(27)12-4-3-5-14(20)8-12/h3-8,11,17,23,26H,1-2H3,(H,24,27)(H,25,28)/t11-,17+/m0/s1 |
| InChIKey | ZOHGUUISZDPSMS-APPDUMDISA-N |
| XLogP | 2.80 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|