C19H19IN4O4 — CID 70671866
N'-[(2R,3S)-2-(4-cyano-3-iodo-2-methylanilino)-3-hydroxybutanoyl]-4-hydroxybenzohydrazide (PubChem CID 70671866) has the molecular formula C19H19IN4O4 and a molecular weight of 494.29 g/mol. Its IUPAC name is N'-[(2R,3S)-2-(4-cyano-3-iodo-2-methylanilino)-3-hydroxybutanoyl]-4-hydroxybenzohydrazide.
| Compound Name | N'-[(2R,3S)-2-(4-cyano-3-iodo-2-methylanilino)-3-hydroxybutanoyl]-4-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 70671866 |
| Molecular Formula | C19H19IN4O4 |
| Molecular Weight | 494.29 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | N'-[(2R,3S)-2-(4-cyano-3-iodo-2-methylanilino)-3-hydroxybutanoyl]-4-hydroxybenzohydrazide |
| SMILES | Cc1c(N[C@@H](C(=O)NNC(=O)c2ccc(O)cc2)[C@H](C)O)ccc(C#N)c1I |
| InChI | InChI=1S/C19H19IN4O4/c1-10-15(8-5-13(9-21)16(10)20)22-17(11(2)25)19(28)24-23-18(27)12-3-6-14(26)7-4-12/h3-8,11,17,22,25-26H,1-2H3,(H,23,27)(H,24,28)/t11-,17+/m0/s1 |
| InChIKey | UMLPWNURQBGXRO-APPDUMDISA-N |
| XLogP | 1.80 |
| TPSA | 134.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|