C25H33ClN4O3Si — CID 67005989
N'-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(3-chloro-4-cyano-2-methylanilino)butanoyl]benzohydrazide (PubChem CID 67005989) has the molecular formula C25H33ClN4O3Si and a molecular weight of 501.10 g/mol. Its IUPAC name is N'-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(3-chloro-4-cyano-2-methylanilino)butanoyl]benzohydrazide.
| Compound Name | N'-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(3-chloro-4-cyano-2-methylanilino)butanoyl]benzohydrazide |
|---|---|
| PubChem CID | 67005989 |
| Molecular Formula | C25H33ClN4O3Si |
| Molecular Weight | 501.10 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | N'-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(3-chloro-4-cyano-2-methylanilino)butanoyl]benzohydrazide |
| SMILES | Cc1c(N[C@@H](C(=O)NNC(=O)c2ccccc2)[C@@H](C)O[Si](C)(C)C(C)(C)C)ccc(C#N)c1Cl |
| InChI | InChI=1S/C25H33ClN4O3Si/c1-16-20(14-13-19(15-27)21(16)26)28-22(17(2)33-34(6,7)25(3,4)5)24(32)30-29-23(31)18-11-9-8-10-12-18/h8-14,17,22,28H,1-7H3,(H,29,31)(H,30,32)/t17-,22-/m1/s1 |
| InChIKey | NCQDDWBNJQEAQV-VGOFRKELSA-N |
| XLogP | 5.17 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.10 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|