C31H46ClFN4O4Si2 — CID 67005983
4-[tert-butyl(dimethyl)silyl]oxy-N'-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(3-chloro-4-cyano-2-methylanilino)butanoyl]-3-fluorobenzohydrazide (PubChem CID 67005983) has the molecular formula C31H46ClFN4O4Si2 and a molecular weight of 649.36 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-N'-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(3-chloro-4-cyano-2-methylanilino)butanoyl]-3-fluorobenzohydrazide.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-N'-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(3-chloro-4-cyano-2-methylanilino)butanoyl]-3-fluorobenzohydrazide |
|---|---|
| PubChem CID | 67005983 |
| Molecular Formula | C31H46ClFN4O4Si2 |
| Molecular Weight | 649.36 g/mol |
| Exact Mass | 648.27 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-N'-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(3-chloro-4-cyano-2-methylanilino)butanoyl]-3-fluorobenzohydrazide |
| SMILES | Cc1c(N[C@@H](C(=O)NNC(=O)c2ccc(O[Si](C)(C)C(C)(C)C)c(F)c2)[C@H](C)O[Si](C)(C)C(C)(C)C)ccc(C#N)c1Cl |
| InChI | InChI=1S/C31H46ClFN4O4Si2/c1-19-24(15-13-22(18-34)26(19)32)35-27(20(2)40-42(9,10)30(3,4)5)29(39)37-36-28(38)21-14-16-25(23(33)17-21)41-43(11,12)31(6,7)8/h13-17,20,27,35H,1-12H3,(H,36,38)(H,37,39)/t20-,27+/m0/s1 |
| InChIKey | SLGMDKJXFUEHGR-CCLHPLFOSA-N |
| XLogP | 7.70 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.36 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|