C26H30F3N5O3Si — CID 67006212
N'-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[4-cyano-3-(trifluoromethyl)anilino]butanoyl]-4-cyanobenzohydrazide (PubChem CID 67006212) has the molecular formula C26H30F3N5O3Si and a molecular weight of 545.64 g/mol. Its IUPAC name is N'-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[4-cyano-3-(trifluoromethyl)anilino]butanoyl]-4-cyanobenzohydrazide.
| Compound Name | N'-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[4-cyano-3-(trifluoromethyl)anilino]butanoyl]-4-cyanobenzohydrazide |
|---|---|
| PubChem CID | 67006212 |
| Molecular Formula | C26H30F3N5O3Si |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | N'-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[4-cyano-3-(trifluoromethyl)anilino]butanoyl]-4-cyanobenzohydrazide |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](Nc1ccc(C#N)c(C(F)(F)F)c1)C(=O)NNC(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C26H30F3N5O3Si/c1-16(37-38(5,6)25(2,3)4)22(32-20-12-11-19(15-31)21(13-20)26(27,28)29)24(36)34-33-23(35)18-9-7-17(14-30)8-10-18/h7-13,16,22,32H,1-6H3,(H,33,35)(H,34,36)/t16-,22-/m1/s1 |
| InChIKey | LCQTWRLIJIDBQQ-OPAMFIHVSA-N |
| XLogP | 5.10 |
| TPSA | 127.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|