C20H18F4N4O3 — CID 67523141
N'-[2-[4-cyano-3-(trifluoromethyl)anilino]-3-hydroxy-3-methylbutanoyl]-4-fluorobenzohydrazide (PubChem CID 67523141) has the molecular formula C20H18F4N4O3 and a molecular weight of 438.38 g/mol. Its IUPAC name is N'-[2-[4-cyano-3-(trifluoromethyl)anilino]-3-hydroxy-3-methylbutanoyl]-4-fluorobenzohydrazide.
| Compound Name | N'-[2-[4-cyano-3-(trifluoromethyl)anilino]-3-hydroxy-3-methylbutanoyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 67523141 |
| Molecular Formula | C20H18F4N4O3 |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | N'-[2-[4-cyano-3-(trifluoromethyl)anilino]-3-hydroxy-3-methylbutanoyl]-4-fluorobenzohydrazide |
| SMILES | CC(C)(O)C(Nc1ccc(C#N)c(C(F)(F)F)c1)C(=O)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H18F4N4O3/c1-19(2,31)16(18(30)28-27-17(29)11-3-6-13(21)7-4-11)26-14-8-5-12(10-25)15(9-14)20(22,23)24/h3-9,16,26,31H,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | BCNFXEOABOGORV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|