C27H27ClN4O5 — CID 91208225
N-[2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]-4-[(4-methoxyphenyl)methoxy]benzohydrazide (PubChem CID 91208225) has the molecular formula C27H27ClN4O5 and a molecular weight of 522.99 g/mol. Its IUPAC name is N-[2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]-4-[(4-methoxyphenyl)methoxy]benzohydrazide.
| Compound Name | N-[2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]-4-[(4-methoxyphenyl)methoxy]benzohydrazide |
|---|---|
| PubChem CID | 91208225 |
| Molecular Formula | C27H27ClN4O5 |
| Molecular Weight | 522.99 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | N-[2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxybutanoyl]-4-[(4-methoxyphenyl)methoxy]benzohydrazide |
| SMILES | COc1ccc(COc2ccc(C(=O)N(N)C(=O)C(Nc3ccc(C#N)c(Cl)c3C)C(C)O)cc2)cc1 |
| InChI | InChI=1S/C27H27ClN4O5/c1-16-23(13-8-20(14-29)24(16)28)31-25(17(2)33)27(35)32(30)26(34)19-6-11-22(12-7-19)37-15-18-4-9-21(36-3)10-5-18/h4-13,17,25,31,33H,15,30H2,1-3H3 |
| InChIKey | NOWWIWSDSVCTLU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.99 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|