C20H20Cl2N4O3 — CID 66625450
4-chloro-N-[(2R)-2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxy-3-methylbutanoyl]benzohydrazide (PubChem CID 66625450) has the molecular formula C20H20Cl2N4O3 and a molecular weight of 435.31 g/mol. Its IUPAC name is 4-chloro-N-[(2R)-2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxy-3-methylbutanoyl]benzohydrazide.
| Compound Name | 4-chloro-N-[(2R)-2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxy-3-methylbutanoyl]benzohydrazide |
|---|---|
| PubChem CID | 66625450 |
| Molecular Formula | C20H20Cl2N4O3 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 4-chloro-N-[(2R)-2-(3-chloro-4-cyano-2-methylanilino)-3-hydroxy-3-methylbutanoyl]benzohydrazide |
| SMILES | Cc1c(N[C@@H](C(=O)N(N)C(=O)c2ccc(Cl)cc2)C(C)(C)O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C20H20Cl2N4O3/c1-11-15(9-6-13(10-23)16(11)22)25-17(20(2,3)29)19(28)26(24)18(27)12-4-7-14(21)8-5-12/h4-9,17,25,29H,24H2,1-3H3/t17-/m0/s1 |
| InChIKey | QUUSUBYUFPRQGB-KRWDZBQOSA-N |
| XLogP | 3.27 |
| TPSA | 119.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|