C16H18ClF3N2O3 — CID 67531076
(2R,3S)-3-butoxy-2-(3-chloro-4-cyano-2-methylanilino)-4,4,4-trifluorobutanoic acid (PubChem CID 67531076) has the molecular formula C16H18ClF3N2O3 and a molecular weight of 378.78 g/mol. Its IUPAC name is (2R,3S)-3-butoxy-2-(3-chloro-4-cyano-2-methylanilino)-4,4,4-trifluorobutanoic acid.
| Compound Name | (2R,3S)-3-butoxy-2-(3-chloro-4-cyano-2-methylanilino)-4,4,4-trifluorobutanoic acid |
|---|---|
| PubChem CID | 67531076 |
| Molecular Formula | C16H18ClF3N2O3 |
| Molecular Weight | 378.78 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | (2R,3S)-3-butoxy-2-(3-chloro-4-cyano-2-methylanilino)-4,4,4-trifluorobutanoic acid |
| SMILES | CCCCO[C@@H]([C@@H](Nc1ccc(C#N)c(Cl)c1C)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C16H18ClF3N2O3/c1-3-4-7-25-14(16(18,19)20)13(15(23)24)22-11-6-5-10(8-21)12(17)9(11)2/h5-6,13-14,22H,3-4,7H2,1-2H3,(H,23,24)/t13-,14+/m1/s1 |
| InChIKey | ZDSJJHRUBLUFQR-KGLIPLIRSA-N |
| XLogP | 4.13 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.78 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|