About (1R)-2-[[6-(2,4-dimethylphenyl)pyrimidin-4-yl]amino]-1-phenylethanol
(1R)-2-[[6-(2,4-dimethylphenyl)pyrimidin-4-yl]amino]-1-phenylethanol (PubChem CID 143851560) has the molecular formula C20H21N3O
and a molecular weight of 319.41 g/mol. Its IUPAC name is (1R)-2-[[6-(2,4-dimethylphenyl)pyrimidin-4-yl]amino]-1-phenylethanol.
Molecular Properties
| Compound Name | (1R)-2-[[6-(2,4-dimethylphenyl)pyrimidin-4-yl]amino]-1-phenylethanol |
| PubChem CID | 143851560 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | (1R)-2-[[6-(2,4-dimethylphenyl)pyrimidin-4-yl]amino]-1-phenylethanol |
| SMILES | Cc1ccc(-c2cc(NC[C@H](O)c3ccccc3)ncn2)c(C)c1 |
| InChI | InChI=1S/C20H21N3O/c1-14-8-9-17(15(2)10-14)18-11-20(23-13-22-18)21-12-19(24)16-6-4-3-5-7-16/h3-11,13,19,24H,12H2,1-2H3,(H,21,22,23)/t19-/m0/s1 |
| InChIKey | REPNNYMOSKFUSU-IBGZPJMESA-N |
| XLogP | 3.91 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1R)-2-[[6-(2,4-dimethylphenyl)pyrimidin-4-yl]amino]-1-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2-[[6-(2,4-dimethylphenyl)pyrimidin-4-yl]amino]-1-phenylethanol?
The IUPAC name of (1R)-2-[[6-(2,4-dimethylphenyl)pyrimidin-4-yl]amino]-1-phenylethanol (CID 143851560) is (1R)-2-[[6-(2,4-dimethylphenyl)pyrimidin-4-yl]amino]-1-phenylethanol.
What is the SMILES notation for (1R)-2-[[6-(2,4-dimethylphenyl)pyrimidin-4-yl]amino]-1-phenylethanol?
The canonical SMILES for (1R)-2-[[6-(2,4-dimethylphenyl)pyrimidin-4-yl]amino]-1-phenylethanol is Cc1ccc(-c2cc(NC[C@H](O)c3ccccc3)ncn2)c(C)c1.
What is the InChIKey of (1R)-2-[[6-(2,4-dimethylphenyl)pyrimidin-4-yl]amino]-1-phenylethanol?
The InChIKey is REPNNYMOSKFUSU-IBGZPJMESA-N. The full InChI is InChI=1S/C20H21N3O/c1-14-8-9-17(15(2)10-14)18-11-20(23-13-22-18)21-12-19(24)16-6-4-3-5-7-16/h3-11,13,19,24H,12H2,1-2H3,(H,21,22,23)/t19-/m0/s1.
What are the key properties of (1R)-2-[[6-(2,4-dimethylphenyl)pyrimidin-4-yl]amino]-1-phenylethanol?
(1R)-2-[[6-(2,4-dimethylphenyl)pyrimidin-4-yl]amino]-1-phenylethanol has a molecular weight of 319.41 g/mol, XLogP of 3.91, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2-[[6-(2,4-dimethylphenyl)pyrimidin-4-yl]amino]-1-phenylethanol is sourced from PubChem (CID 143851560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).