C20H21N3O — CID 143851560
(1R)-2-[[6-(2,4-dimethylphenyl)pyrimidin-4-yl]amino]-1-phenylethanol (PubChem CID 143851560) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is (1R)-2-[[6-(2,4-dimethylphenyl)pyrimidin-4-yl]amino]-1-phenylethanol.
| Compound Name | (1R)-2-[[6-(2,4-dimethylphenyl)pyrimidin-4-yl]amino]-1-phenylethanol |
|---|---|
| PubChem CID | 143851560 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | (1R)-2-[[6-(2,4-dimethylphenyl)pyrimidin-4-yl]amino]-1-phenylethanol |
| SMILES | Cc1ccc(-c2cc(NC[C@H](O)c3ccccc3)ncn2)c(C)c1 |
| InChI | InChI=1S/C20H21N3O/c1-14-8-9-17(15(2)10-14)18-11-20(23-13-22-18)21-12-19(24)16-6-4-3-5-7-16/h3-11,13,19,24H,12H2,1-2H3,(H,21,22,23)/t19-/m0/s1 |
| InChIKey | REPNNYMOSKFUSU-IBGZPJMESA-N |
| XLogP | 3.91 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |