C7H10N4S — CID 143852547
6-sulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-amine (PubChem CID 143852547) has the molecular formula C7H10N4S and a molecular weight of 182.25 g/mol. Its IUPAC name is 6-sulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-amine.
| Compound Name | 6-sulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 143852547 |
| Molecular Formula | C7H10N4S |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 6-sulfanyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-amine |
| SMILES | Nc1ncc2c(n1)CCN(S)C2 |
| InChI | InChI=1S/C7H10N4S/c8-7-9-3-5-4-11(12)2-1-6(5)10-7/h3,12H,1-2,4H2,(H2,8,9,10) |
| InChIKey | UENUGIYDHANLKC-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|