C13H14ClN5 — CID 24911370
6-[(2-chloro-3-pyridinyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-amine (PubChem CID 24911370) has the molecular formula C13H14ClN5 and a molecular weight of 275.74 g/mol. Its IUPAC name is 6-[(2-chloro-3-pyridinyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-amine.
| Compound Name | 6-[(2-chloro-3-pyridinyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 24911370 |
| Molecular Formula | C13H14ClN5 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 6-[(2-chloro-3-pyridinyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-amine |
| SMILES | Nc1ncc2c(n1)CCN(Cc1cccnc1Cl)C2 |
| InChI | InChI=1S/C13H14ClN5/c14-12-9(2-1-4-16-12)7-19-5-3-11-10(8-19)6-17-13(15)18-11/h1-2,4,6H,3,5,7-8H2,(H2,15,17,18) |
| InChIKey | AXFJKXVSGPQICL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|