About 2-methylpyridine;5-methyl-2-(trifluoromethyl)pyridine
2-methylpyridine;5-methyl-2-(trifluoromethyl)pyridine (PubChem CID 143854771) has the molecular formula C13H13F3N2
and a molecular weight of 254.26 g/mol. Its IUPAC name is 2-methylpyridine;5-methyl-2-(trifluoromethyl)pyridine.
Molecular Properties
| Compound Name | 2-methylpyridine;5-methyl-2-(trifluoromethyl)pyridine |
| PubChem CID | 143854771 |
| Molecular Formula | C13H13F3N2 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 2-methylpyridine;5-methyl-2-(trifluoromethyl)pyridine |
| SMILES | Cc1ccc(C(F)(F)F)nc1.Cc1ccccn1 |
| InChI | InChI=1S/C7H6F3N.C6H7N/c1-5-2-3-6(11-4-5)7(8,9)10;1-6-4-2-3-5-7-6/h2-4H,1H3;2-5H,1H3 |
| InChIKey | IDNPCHQBMSYACU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpyridine;5-methyl-2-(trifluoromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpyridine;5-methyl-2-(trifluoromethyl)pyridine?
The IUPAC name of 2-methylpyridine;5-methyl-2-(trifluoromethyl)pyridine (CID 143854771) is 2-methylpyridine;5-methyl-2-(trifluoromethyl)pyridine.
What is the SMILES notation for 2-methylpyridine;5-methyl-2-(trifluoromethyl)pyridine?
The canonical SMILES for 2-methylpyridine;5-methyl-2-(trifluoromethyl)pyridine is Cc1ccc(C(F)(F)F)nc1.Cc1ccccn1.
What is the InChIKey of 2-methylpyridine;5-methyl-2-(trifluoromethyl)pyridine?
The InChIKey is IDNPCHQBMSYACU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3N.C6H7N/c1-5-2-3-6(11-4-5)7(8,9)10;1-6-4-2-3-5-7-6/h2-4H,1H3;2-5H,1H3.
What are the key properties of 2-methylpyridine;5-methyl-2-(trifluoromethyl)pyridine?
2-methylpyridine;5-methyl-2-(trifluoromethyl)pyridine has a molecular weight of 254.26 g/mol, XLogP of 3.80, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpyridine;5-methyl-2-(trifluoromethyl)pyridine is sourced from PubChem (CID 143854771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).