C26H29FO6S — CID 143857012
(1S,4R,8S,9S,11S,12R,13S,19S)-12-fluoro-11-hydroxy-9,13,19-trimethyl-16-oxo-6-thiophen-2-yl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-diene-8-carboxylic acid (PubChem CID 143857012) has the molecular formula C26H29FO6S and a molecular weight of 488.58 g/mol. Its IUPAC name is (1S,4R,8S,9S,11S,12R,13S,19S)-12-fluoro-11-hydroxy-9,13,19-trimethyl-16-oxo-6-thiophen-2-yl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-diene-8-carboxylic acid.
| Compound Name | (1S,4R,8S,9S,11S,12R,13S,19S)-12-fluoro-11-hydroxy-9,13,19-trimethyl-16-oxo-6-thiophen-2-yl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-diene-8-carboxylic acid |
|---|---|
| PubChem CID | 143857012 |
| Molecular Formula | C26H29FO6S |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | (1S,4R,8S,9S,11S,12R,13S,19S)-12-fluoro-11-hydroxy-9,13,19-trimethyl-16-oxo-6-thiophen-2-yl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-diene-8-carboxylic acid |
| SMILES | C[C@H]1C[C@H]2C3C[C@H]4OC(c5cccs5)O[C@@]4(C(=O)O)[C@@]3(C)C[C@H](O)[C@]2(F)[C@@]2(C)C=CC(=O)C=C12 |
| InChI | InChI=1S/C26H29FO6S/c1-13-9-17-16-11-20-26(22(30)31,33-21(32-20)18-5-4-8-34-18)24(16,3)12-19(29)25(17,27)23(2)7-6-14(28)10-15(13)23/h4-8,10,13,16-17,19-21,29H,9,11-12H2,1-3H3,(H,30,31)/t13-,16?,17-,19-,20+,21?,23-,24-,25-,26-/m0/s1 |
| InChIKey | IEUQZLOVAQFGKA-SMDCNAQWSA-N |
| XLogP | 4.21 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |