C28H31F2NO6S2 — CID 58529111
S-(dimethylcarbamoyl) (1S,2S,4R,8S,9S,11S,12R,13S,19S)-12,19-difluoro-11-hydroxy-9,13-dimethyl-16-oxo-6-thiophen-2-yl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-diene-8-carbothioate (PubChem CID 58529111) has the molecular formula C28H31F2NO6S2 and a molecular weight of 579.69 g/mol. Its IUPAC name is S-(dimethylcarbamoyl) (1S,2S,4R,8S,9S,11S,12R,13S,19S)-12,19-difluoro-11-hydroxy-9,13-dimethyl-16-oxo-6-thiophen-2-yl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-diene-8-carbothioate.
| Compound Name | S-(dimethylcarbamoyl) (1S,2S,4R,8S,9S,11S,12R,13S,19S)-12,19-difluoro-11-hydroxy-9,13-dimethyl-16-oxo-6-thiophen-2-yl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-diene-8-carbothioate |
|---|---|
| PubChem CID | 58529111 |
| Molecular Formula | C28H31F2NO6S2 |
| Molecular Weight | 579.69 g/mol |
| Exact Mass | 579.16 |
| IUPAC Name | S-(dimethylcarbamoyl) (1S,2S,4R,8S,9S,11S,12R,13S,19S)-12,19-difluoro-11-hydroxy-9,13-dimethyl-16-oxo-6-thiophen-2-yl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-diene-8-carbothioate |
| SMILES | CN(C)C(=O)SC(=O)[C@@]12OC(c3cccs3)O[C@@H]1C[C@H]1[C@@H]3C[C@H](F)C4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@@]12C |
| InChI | InChI=1S/C28H31F2NO6S2/c1-25-8-7-14(32)10-17(25)18(29)11-16-15-12-21-28(23(34)39-24(35)31(3)4,26(15,2)13-20(33)27(16,25)30)37-22(36-21)19-6-5-9-38-19/h5-10,15-16,18,20-22,33H,11-13H2,1-4H3/t15-,16-,18-,20-,21+,22?,25-,26-,27-,28-/m0/s1 |
| InChIKey | YDAYAZLCQFJKKT-MFISCCSBSA-N |
| XLogP | 4.77 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.69 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|