C7H8N2S — CID 143857289
2,3-dihydroimidazo[1,2-a]pyridine-2-thiol (PubChem CID 143857289) has the molecular formula C7H8N2S and a molecular weight of 152.22 g/mol. Its IUPAC name is 2,3-dihydroimidazo[1,2-a]pyridine-2-thiol.
| Compound Name | 2,3-dihydroimidazo[1,2-a]pyridine-2-thiol |
|---|---|
| PubChem CID | 143857289 |
| Molecular Formula | C7H8N2S |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 2,3-dihydroimidazo[1,2-a]pyridine-2-thiol |
| SMILES | SC1CN2C=CC=CC2=N1 |
| InChI | InChI=1S/C7H8N2S/c10-7-5-9-4-2-1-3-6(9)8-7/h1-4,7,10H,5H2 |
| InChIKey | JABAZIBWXOOPKJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|