C7H11N2P — CID 178089076
2,3-dihydroimidazo[1,2-a]pyridine;phosphane (PubChem CID 178089076) has the molecular formula C7H11N2P and a molecular weight of 154.15 g/mol. Its IUPAC name is 2,3-dihydroimidazo[1,2-a]pyridine;phosphane.
| Compound Name | 2,3-dihydroimidazo[1,2-a]pyridine;phosphane |
|---|---|
| PubChem CID | 178089076 |
| Molecular Formula | C7H11N2P |
| Molecular Weight | 154.15 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 2,3-dihydroimidazo[1,2-a]pyridine;phosphane |
| SMILES | C1=CC2=NCCN2C=C1.P |
| InChI | InChI=1S/C7H8N2.H3P/c1-2-5-9-6-4-8-7(9)3-1;/h1-3,5H,4,6H2;1H3 |
| InChIKey | MRRVMLGJSLACQZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.15 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|