C7H7N3 — CID 28812095
3H-imidazo[1,2-a]pyridin-2-imine (PubChem CID 28812095) has the molecular formula C7H7N3 and a molecular weight of 133.15 g/mol. Its IUPAC name is 3H-imidazo[1,2-a]pyridin-2-imine.
| Compound Name | 3H-imidazo[1,2-a]pyridin-2-imine |
|---|---|
| PubChem CID | 28812095 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 3H-imidazo[1,2-a]pyridin-2-imine |
| SMILES | [H]/N=C1/CN2C=CC=CC2=N1 |
| InChI | InChI=1S/C7H7N3/c8-6-5-10-4-2-1-3-7(10)9-6/h1-4,8H,5H2/b8-6- |
| InChIKey | HUXFKNRPTAJICY-VURMDHGXSA-N |
| XLogP | 0.76 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|