C17H25NO4S — CID 143858277
4-[2-(3-hydroxybut-3-enyl)piperidin-1-yl]sulfonyl-2,5-dimethylphenol (PubChem CID 143858277) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is 4-[2-(3-hydroxybut-3-enyl)piperidin-1-yl]sulfonyl-2,5-dimethylphenol.
| Compound Name | 4-[2-(3-hydroxybut-3-enyl)piperidin-1-yl]sulfonyl-2,5-dimethylphenol |
|---|---|
| PubChem CID | 143858277 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 4-[2-(3-hydroxybut-3-enyl)piperidin-1-yl]sulfonyl-2,5-dimethylphenol |
| SMILES | C=C(O)CCC1CCCCN1S(=O)(=O)c1cc(C)c(O)cc1C |
| InChI | InChI=1S/C17H25NO4S/c1-12-11-17(13(2)10-16(12)20)23(21,22)18-9-5-4-6-15(18)8-7-14(3)19/h10-11,15,19-20H,3-9H2,1-2H3 |
| InChIKey | ZHELGIHOQZQGDD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|