C9H18O2S — CID 14386123
S-ethyl (2S,3R)-3-hydroxy-2,4-dimethylpentanethioate (PubChem CID 14386123) has the molecular formula C9H18O2S and a molecular weight of 190.31 g/mol. Its IUPAC name is S-ethyl (2S,3R)-3-hydroxy-2,4-dimethylpentanethioate.
| Compound Name | S-ethyl (2S,3R)-3-hydroxy-2,4-dimethylpentanethioate |
|---|---|
| PubChem CID | 14386123 |
| Molecular Formula | C9H18O2S |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | S-ethyl (2S,3R)-3-hydroxy-2,4-dimethylpentanethioate |
| SMILES | CCSC(=O)[C@@H](C)[C@H](O)C(C)C |
| InChI | InChI=1S/C9H18O2S/c1-5-12-9(11)7(4)8(10)6(2)3/h6-8,10H,5H2,1-4H3/t7-,8+/m0/s1 |
| InChIKey | FUTCWGYFYPRVAM-JGVFFNPUSA-N |
| XLogP | 1.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|