C11H22O2S — CID 12501848
S-tert-butyl (2R,3R)-3-hydroxy-2,4-dimethylpentanethioate (PubChem CID 12501848) has the molecular formula C11H22O2S and a molecular weight of 218.36 g/mol. Its IUPAC name is S-tert-butyl (2R,3R)-3-hydroxy-2,4-dimethylpentanethioate.
| Compound Name | S-tert-butyl (2R,3R)-3-hydroxy-2,4-dimethylpentanethioate |
|---|---|
| PubChem CID | 12501848 |
| Molecular Formula | C11H22O2S |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | S-tert-butyl (2R,3R)-3-hydroxy-2,4-dimethylpentanethioate |
| SMILES | CC(C)[C@@H](O)[C@@H](C)C(=O)SC(C)(C)C |
| InChI | InChI=1S/C11H22O2S/c1-7(2)9(12)8(3)10(13)14-11(4,5)6/h7-9,12H,1-6H3/t8-,9-/m1/s1 |
| InChIKey | YRXHHJZETFHASN-RKDXNWHRSA-N |
| XLogP | 2.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|