C11H20F2O2S — CID 10824854
S-tert-butyl 2,2-difluoro-3-hydroxy-4,4-dimethylpentanethioate (PubChem CID 10824854) has the molecular formula C11H20F2O2S and a molecular weight of 254.34 g/mol. Its IUPAC name is S-tert-butyl 2,2-difluoro-3-hydroxy-4,4-dimethylpentanethioate.
| Compound Name | S-tert-butyl 2,2-difluoro-3-hydroxy-4,4-dimethylpentanethioate |
|---|---|
| PubChem CID | 10824854 |
| Molecular Formula | C11H20F2O2S |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | S-tert-butyl 2,2-difluoro-3-hydroxy-4,4-dimethylpentanethioate |
| SMILES | CC(C)(C)SC(=O)C(F)(F)C(O)C(C)(C)C |
| InChI | InChI=1S/C11H20F2O2S/c1-9(2,3)7(14)11(12,13)8(15)16-10(4,5)6/h7,14H,1-6H3 |
| InChIKey | FBELNAUWWSOSEV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|