S-tert-butyl 2,2-difluoro-3-hydroxy-4-methylhexanethioate

C11H20F2O2S — CID 154448258

IUPACS-tert-butyl 2,2-difluoro-3-hydroxy-4-methylhexanethioate
SMILESCCC(C)C(O)C(F)(F)C(=O)SC(C)(C)C
InChIInChI=1S/C11H20F2O2S/c1-6-7(2)8(14)11(12,13)9(15)16-10(3,4)5/h7-8,14H,6H2,1-5H3
InChIKeyQYVMXEAUDWDVEJ-UHFFFAOYSA-N
MW254.34 g/mol
LogP3.09
Rot. Bonds4

About S-tert-butyl 2,2-difluoro-3-hydroxy-4-methylhexanethioate

S-tert-butyl 2,2-difluoro-3-hydroxy-4-methylhexanethioate (PubChem CID 154448258) has the molecular formula C11H20F2O2S and a molecular weight of 254.34 g/mol. Its IUPAC name is S-tert-butyl 2,2-difluoro-3-hydroxy-4-methylhexanethioate.

Molecular Properties

Compound NameS-tert-butyl 2,2-difluoro-3-hydroxy-4-methylhexanethioate
PubChem CID154448258
Molecular FormulaC11H20F2O2S
Molecular Weight254.34 g/mol
Exact Mass254.12
IUPAC NameS-tert-butyl 2,2-difluoro-3-hydroxy-4-methylhexanethioate
SMILESCCC(C)C(O)C(F)(F)C(=O)SC(C)(C)C
InChIInChI=1S/C11H20F2O2S/c1-6-7(2)8(14)11(12,13)9(15)16-10(3,4)5/h7-8,14H,6H2,1-5H3
InChIKeyQYVMXEAUDWDVEJ-UHFFFAOYSA-N
XLogP3.09
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.34
LogP ≤ 53.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thioester', 'substructure': 'N/A'}

Analyze S-tert-butyl 2,2-difluoro-3-hydroxy-4-methylhexanethioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of S-tert-butyl 2,2-difluoro-3-hydroxy-4-methylhexanethioate?
The IUPAC name of S-tert-butyl 2,2-difluoro-3-hydroxy-4-methylhexanethioate (CID 154448258) is S-tert-butyl 2,2-difluoro-3-hydroxy-4-methylhexanethioate.
What is the SMILES notation for S-tert-butyl 2,2-difluoro-3-hydroxy-4-methylhexanethioate?
The canonical SMILES for S-tert-butyl 2,2-difluoro-3-hydroxy-4-methylhexanethioate is CCC(C)C(O)C(F)(F)C(=O)SC(C)(C)C.
What is the InChIKey of S-tert-butyl 2,2-difluoro-3-hydroxy-4-methylhexanethioate?
The InChIKey is QYVMXEAUDWDVEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F2O2S/c1-6-7(2)8(14)11(12,13)9(15)16-10(3,4)5/h7-8,14H,6H2,1-5H3.
What are the key properties of S-tert-butyl 2,2-difluoro-3-hydroxy-4-methylhexanethioate?
S-tert-butyl 2,2-difluoro-3-hydroxy-4-methylhexanethioate has a molecular weight of 254.34 g/mol, XLogP of 3.09, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-tert-butyl 2,2-difluoro-3-hydroxy-4-methylhexanethioate is sourced from PubChem (CID 154448258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).