C11H20F2O2S — CID 154448258
S-tert-butyl 2,2-difluoro-3-hydroxy-4-methylhexanethioate (PubChem CID 154448258) has the molecular formula C11H20F2O2S and a molecular weight of 254.34 g/mol. Its IUPAC name is S-tert-butyl 2,2-difluoro-3-hydroxy-4-methylhexanethioate.
| Compound Name | S-tert-butyl 2,2-difluoro-3-hydroxy-4-methylhexanethioate |
|---|---|
| PubChem CID | 154448258 |
| Molecular Formula | C11H20F2O2S |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | S-tert-butyl 2,2-difluoro-3-hydroxy-4-methylhexanethioate |
| SMILES | CCC(C)C(O)C(F)(F)C(=O)SC(C)(C)C |
| InChI | InChI=1S/C11H20F2O2S/c1-6-7(2)8(14)11(12,13)9(15)16-10(3,4)5/h7-8,14H,6H2,1-5H3 |
| InChIKey | QYVMXEAUDWDVEJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|