C12H24O2S — CID 10443964
S-tert-butyl (2S,3S)-2-ethyl-3-hydroxy-4-methylpentanethioate (PubChem CID 10443964) has the molecular formula C12H24O2S and a molecular weight of 232.39 g/mol. Its IUPAC name is S-tert-butyl (2S,3S)-2-ethyl-3-hydroxy-4-methylpentanethioate.
| Compound Name | S-tert-butyl (2S,3S)-2-ethyl-3-hydroxy-4-methylpentanethioate |
|---|---|
| PubChem CID | 10443964 |
| Molecular Formula | C12H24O2S |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | S-tert-butyl (2S,3S)-2-ethyl-3-hydroxy-4-methylpentanethioate |
| SMILES | CC[C@H](C(=O)SC(C)(C)C)[C@@H](O)C(C)C |
| InChI | InChI=1S/C12H24O2S/c1-7-9(10(13)8(2)3)11(14)15-12(4,5)6/h8-10,13H,7H2,1-6H3/t9-,10-/m0/s1 |
| InChIKey | ZXSXUZUTODRUPO-UWVGGRQHSA-N |
| XLogP | 3.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|