C10H20O2S — CID 134931362
S-ethyl (2R,3S)-3-hydroxy-2,4,4-trimethylpentanethioate (PubChem CID 134931362) has the molecular formula C10H20O2S and a molecular weight of 204.33 g/mol. Its IUPAC name is S-ethyl (2R,3S)-3-hydroxy-2,4,4-trimethylpentanethioate.
| Compound Name | S-ethyl (2R,3S)-3-hydroxy-2,4,4-trimethylpentanethioate |
|---|---|
| PubChem CID | 134931362 |
| Molecular Formula | C10H20O2S |
| Molecular Weight | 204.33 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | S-ethyl (2R,3S)-3-hydroxy-2,4,4-trimethylpentanethioate |
| SMILES | CCSC(=O)[C@H](C)[C@H](O)C(C)(C)C |
| InChI | InChI=1S/C10H20O2S/c1-6-13-9(12)7(2)8(11)10(3,4)5/h7-8,11H,6H2,1-5H3/t7-,8+/m1/s1 |
| InChIKey | KWKQKAGBMDZRRQ-SFYZADRCSA-N |
| XLogP | 2.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|