C21H24FN7O3 — CID 143861968
N-ethyl-2-[3-[[5-fluoro-4-[2-(2-hydroxy-2-methylhydrazinyl)anilino]pyrimidin-2-yl]amino]phenoxy]acetamide (PubChem CID 143861968) has the molecular formula C21H24FN7O3 and a molecular weight of 441.47 g/mol. Its IUPAC name is N-ethyl-2-[3-[[5-fluoro-4-[2-(2-hydroxy-2-methylhydrazinyl)anilino]pyrimidin-2-yl]amino]phenoxy]acetamide.
| Compound Name | N-ethyl-2-[3-[[5-fluoro-4-[2-(2-hydroxy-2-methylhydrazinyl)anilino]pyrimidin-2-yl]amino]phenoxy]acetamide |
|---|---|
| PubChem CID | 143861968 |
| Molecular Formula | C21H24FN7O3 |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | N-ethyl-2-[3-[[5-fluoro-4-[2-(2-hydroxy-2-methylhydrazinyl)anilino]pyrimidin-2-yl]amino]phenoxy]acetamide |
| SMILES | CCNC(=O)COc1cccc(Nc2ncc(F)c(Nc3ccccc3NN(C)O)n2)c1 |
| InChI | InChI=1S/C21H24FN7O3/c1-3-23-19(30)13-32-15-8-6-7-14(11-15)25-21-24-12-16(22)20(27-21)26-17-9-4-5-10-18(17)28-29(2)31/h4-12,28,31H,3,13H2,1-2H3,(H,23,30)(H2,24,25,26,27) |
| InChIKey | ATKXJRWCILSDMQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 123.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|