C27H46O7 — CID 143863221
(3R)-10,13-dimethyl-17-[(2R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-1,2,3,4,5,6,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2,3,6,14-tetrol (PubChem CID 143863221) has the molecular formula C27H46O7 and a molecular weight of 482.66 g/mol. Its IUPAC name is (3R)-10,13-dimethyl-17-[(2R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-1,2,3,4,5,6,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2,3,6,14-tetrol.
| Compound Name | (3R)-10,13-dimethyl-17-[(2R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-1,2,3,4,5,6,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2,3,6,14-tetrol |
|---|---|
| PubChem CID | 143863221 |
| Molecular Formula | C27H46O7 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.32 |
| IUPAC Name | (3R)-10,13-dimethyl-17-[(2R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-1,2,3,4,5,6,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2,3,6,14-tetrol |
| SMILES | CC(C)(O)CCC(O)[C@](C)(O)C1CCC2(O)C3=CC(O)C4C[C@@H](O)C(O)CC4(C)C3CCC12C |
| InChI | InChI=1S/C27H46O7/c1-23(2,32)9-8-22(31)26(5,33)21-7-11-27(34)16-12-18(28)17-13-19(29)20(30)14-24(17,3)15(16)6-10-25(21,27)4/h12,15,17-22,28-34H,6-11,13-14H2,1-5H3/t15?,17?,18?,19-,20?,21?,22?,24?,25?,26-,27?/m1/s1 |
| InChIKey | ISOMCTRTHAJGHD-CXCMYCLISA-N |
| XLogP | 1.65 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|