C27H45NO7 — CID 91173082
(2S,3R,5R,9R,10R,13R,14S,17S)-10,13-dimethyl-6-nitroso-17-[(2R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-1,2,3,4,5,6,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2,3,14-triol (PubChem CID 91173082) has the molecular formula C27H45NO7 and a molecular weight of 495.66 g/mol. Its IUPAC name is (2S,3R,5R,9R,10R,13R,14S,17S)-10,13-dimethyl-6-nitroso-17-[(2R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-1,2,3,4,5,6,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2,3,14-triol.
| Compound Name | (2S,3R,5R,9R,10R,13R,14S,17S)-10,13-dimethyl-6-nitroso-17-[(2R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-1,2,3,4,5,6,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2,3,14-triol |
|---|---|
| PubChem CID | 91173082 |
| Molecular Formula | C27H45NO7 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | (2S,3R,5R,9R,10R,13R,14S,17S)-10,13-dimethyl-6-nitroso-17-[(2R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-1,2,3,4,5,6,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2,3,14-triol |
| SMILES | CC(C)(O)CCC(O)[C@](C)(O)[C@H]1CC[C@@]2(O)C3=CC(N=O)[C@@H]4C[C@@H](O)[C@@H](O)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H45NO7/c1-23(2,32)9-8-22(31)26(5,33)21-7-11-27(34)16-12-18(28-35)17-13-19(29)20(30)14-24(17,3)15(16)6-10-25(21,27)4/h12,15,17-22,29-34H,6-11,13-14H2,1-5H3/t15-,17-,18?,19+,20-,21-,22?,24+,25+,26+,27+/m0/s1 |
| InChIKey | GHLCDPUWTGFVPJ-FKDXRHKLSA-N |
| XLogP | 2.42 |
| TPSA | 150.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|