C26H38N2O — CID 143863825
1-(5-methoxycyclohepta-1,3,4,6-tetraen-1-yl)-N-[(2-piperidin-1-ylcyclohepta-1,4,6-trien-1-yl)methyl]methanamine;2-methylpropane (PubChem CID 143863825) has the molecular formula C26H38N2O and a molecular weight of 394.60 g/mol. Its IUPAC name is 1-(5-methoxycyclohepta-1,3,4,6-tetraen-1-yl)-N-[(2-piperidin-1-ylcyclohepta-1,4,6-trien-1-yl)methyl]methanamine;2-methylpropane.
| Compound Name | 1-(5-methoxycyclohepta-1,3,4,6-tetraen-1-yl)-N-[(2-piperidin-1-ylcyclohepta-1,4,6-trien-1-yl)methyl]methanamine;2-methylpropane |
|---|---|
| PubChem CID | 143863825 |
| Molecular Formula | C26H38N2O |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.30 |
| IUPAC Name | 1-(5-methoxycyclohepta-1,3,4,6-tetraen-1-yl)-N-[(2-piperidin-1-ylcyclohepta-1,4,6-trien-1-yl)methyl]methanamine;2-methylpropane |
| SMILES | CC(C)C.COC1=C=CC=C(CNCC2=C(N3CCCCC3)CC=CC=C2)C=C1 |
| InChI | InChI=1S/C22H28N2O.C4H10/c1-25-21-11-8-9-19(13-14-21)17-23-18-20-10-4-2-5-12-22(20)24-15-6-3-7-16-24;1-4(2)3/h2,4-5,8-10,13-14,23H,3,6-7,12,15-18H2,1H3;4H,1-3H3 |
| InChIKey | MZXZIQTXRDLGOG-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |