C16H16ClNO2S — CID 143864076
[4-(2-chloro-6-methylphenyl)sulfanyl-2,3-dihydro-1,4-benzoxazin-3-yl]methanol (PubChem CID 143864076) has the molecular formula C16H16ClNO2S and a molecular weight of 321.83 g/mol. Its IUPAC name is [4-(2-chloro-6-methylphenyl)sulfanyl-2,3-dihydro-1,4-benzoxazin-3-yl]methanol.
| Compound Name | [4-(2-chloro-6-methylphenyl)sulfanyl-2,3-dihydro-1,4-benzoxazin-3-yl]methanol |
|---|---|
| PubChem CID | 143864076 |
| Molecular Formula | C16H16ClNO2S |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | [4-(2-chloro-6-methylphenyl)sulfanyl-2,3-dihydro-1,4-benzoxazin-3-yl]methanol |
| SMILES | Cc1cccc(Cl)c1SN1c2ccccc2OCC1CO |
| InChI | InChI=1S/C16H16ClNO2S/c1-11-5-4-6-13(17)16(11)21-18-12(9-19)10-20-15-8-3-2-7-14(15)18/h2-8,12,19H,9-10H2,1H3 |
| InChIKey | LJTBCONQQNZTAW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|