C24H31NO5S — CID 143873757
tert-butyl 2-[[4-(4-methoxy-2,6-dimethylphenyl)sulfanyl-2,3-dihydro-1,4-benzoxazin-3-yl]methoxy]acetate (PubChem CID 143873757) has the molecular formula C24H31NO5S and a molecular weight of 445.58 g/mol. Its IUPAC name is tert-butyl 2-[[4-(4-methoxy-2,6-dimethylphenyl)sulfanyl-2,3-dihydro-1,4-benzoxazin-3-yl]methoxy]acetate.
| Compound Name | tert-butyl 2-[[4-(4-methoxy-2,6-dimethylphenyl)sulfanyl-2,3-dihydro-1,4-benzoxazin-3-yl]methoxy]acetate |
|---|---|
| PubChem CID | 143873757 |
| Molecular Formula | C24H31NO5S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | tert-butyl 2-[[4-(4-methoxy-2,6-dimethylphenyl)sulfanyl-2,3-dihydro-1,4-benzoxazin-3-yl]methoxy]acetate |
| SMILES | COc1cc(C)c(SN2c3ccccc3OCC2COCC(=O)OC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C24H31NO5S/c1-16-11-19(27-6)12-17(2)23(16)31-25-18(13-28-15-22(26)30-24(3,4)5)14-29-21-10-8-7-9-20(21)25/h7-12,18H,13-15H2,1-6H3 |
| InChIKey | ZLONIZWBQOSIHB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|