C13H23NS — CID 143866493
(3Z,5E)-N-methyl-5-methylsulfanyl-N-propylocta-3,5,7-trien-1-amine (PubChem CID 143866493) has the molecular formula C13H23NS and a molecular weight of 225.40 g/mol. Its IUPAC name is (3Z,5E)-N-methyl-5-methylsulfanyl-N-propylocta-3,5,7-trien-1-amine.
| Compound Name | (3Z,5E)-N-methyl-5-methylsulfanyl-N-propylocta-3,5,7-trien-1-amine |
|---|---|
| PubChem CID | 143866493 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | (3Z,5E)-N-methyl-5-methylsulfanyl-N-propylocta-3,5,7-trien-1-amine |
| SMILES | C=C/C=C(\C=C/CCN(C)CCC)SC |
| InChI | InChI=1S/C13H23NS/c1-5-9-13(15-4)10-7-8-12-14(3)11-6-2/h5,7,9-10H,1,6,8,11-12H2,2-4H3/b10-7-,13-9+ |
| InChIKey | NVQWJMRRQGURRP-JWUMZWSUSA-N |
| XLogP | 3.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|