C11H16O3 — CID 14386767
6,6-dimethoxy-2,3,7,7a-tetrahydro-1H-inden-5-one (PubChem CID 14386767) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 6,6-dimethoxy-2,3,7,7a-tetrahydro-1H-inden-5-one.
| Compound Name | 6,6-dimethoxy-2,3,7,7a-tetrahydro-1H-inden-5-one |
|---|---|
| PubChem CID | 14386767 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 6,6-dimethoxy-2,3,7,7a-tetrahydro-1H-inden-5-one |
| SMILES | COC1(OC)CC2CCCC2=CC1=O |
| InChI | InChI=1S/C11H16O3/c1-13-11(14-2)7-9-5-3-4-8(9)6-10(11)12/h6,9H,3-5,7H2,1-2H3 |
| InChIKey | CHQZWILGKDHFPI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|