C17H26N4O2 — CID 143871154
2-(cyclohexylmethyl)-5-methanimidoyl-4-(oxan-3-ylamino)-1H-pyrimidin-6-one (PubChem CID 143871154) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-5-methanimidoyl-4-(oxan-3-ylamino)-1H-pyrimidin-6-one.
| Compound Name | 2-(cyclohexylmethyl)-5-methanimidoyl-4-(oxan-3-ylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 143871154 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 2-(cyclohexylmethyl)-5-methanimidoyl-4-(oxan-3-ylamino)-1H-pyrimidin-6-one |
| SMILES | [H]/N=C/c1c(NC2CCCOC2)nc(CC2CCCCC2)[nH]c1=O |
| InChI | InChI=1S/C17H26N4O2/c18-10-14-16(19-13-7-4-8-23-11-13)20-15(21-17(14)22)9-12-5-2-1-3-6-12/h10,12-13,18H,1-9,11H2,(H2,19,20,21,22)/b18-10+ |
| InChIKey | FYIIVQJXTOZICO-VCHYOVAHSA-N |
| XLogP | 2.48 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|