C17H24F2N4O2 — CID 143871216
2-[(4,4-difluorocyclohexyl)methyl]-5-methanimidoyl-4-(oxan-4-ylamino)-1H-pyrimidin-6-one (PubChem CID 143871216) has the molecular formula C17H24F2N4O2 and a molecular weight of 354.40 g/mol. Its IUPAC name is 2-[(4,4-difluorocyclohexyl)methyl]-5-methanimidoyl-4-(oxan-4-ylamino)-1H-pyrimidin-6-one.
| Compound Name | 2-[(4,4-difluorocyclohexyl)methyl]-5-methanimidoyl-4-(oxan-4-ylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 143871216 |
| Molecular Formula | C17H24F2N4O2 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 2-[(4,4-difluorocyclohexyl)methyl]-5-methanimidoyl-4-(oxan-4-ylamino)-1H-pyrimidin-6-one |
| SMILES | [H]/N=C/c1c(NC2CCOCC2)nc(CC2CCC(F)(F)CC2)[nH]c1=O |
| InChI | InChI=1S/C17H24F2N4O2/c18-17(19)5-1-11(2-6-17)9-14-22-15(13(10-20)16(24)23-14)21-12-3-7-25-8-4-12/h10-12,20H,1-9H2,(H2,21,22,23,24)/b20-10+ |
| InChIKey | JGTDTMTWBCKJIE-KEBDBYFISA-N |
| XLogP | 2.73 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|