C14H19F3N4O2 — CID 143871204
5-methanimidoyl-4-(oxan-4-ylamino)-2-(4,4,4-trifluorobutyl)-1H-pyrimidin-6-one (PubChem CID 143871204) has the molecular formula C14H19F3N4O2 and a molecular weight of 332.33 g/mol. Its IUPAC name is 5-methanimidoyl-4-(oxan-4-ylamino)-2-(4,4,4-trifluorobutyl)-1H-pyrimidin-6-one.
| Compound Name | 5-methanimidoyl-4-(oxan-4-ylamino)-2-(4,4,4-trifluorobutyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 143871204 |
| Molecular Formula | C14H19F3N4O2 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 5-methanimidoyl-4-(oxan-4-ylamino)-2-(4,4,4-trifluorobutyl)-1H-pyrimidin-6-one |
| SMILES | [H]/N=C/c1c(NC2CCOCC2)nc(CCCC(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C14H19F3N4O2/c15-14(16,17)5-1-2-11-20-12(10(8-18)13(22)21-11)19-9-3-6-23-7-4-9/h8-9,18H,1-7H2,(H2,19,20,21,22)/b18-8+ |
| InChIKey | YMEOZZFZUAZACK-QGMBQPNBSA-N |
| XLogP | 2.24 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|