C20H21F3N2O2S — CID 143872470
ethyl (E)-2-[3-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propyliminomethyl]but-2-enoate (PubChem CID 143872470) has the molecular formula C20H21F3N2O2S and a molecular weight of 410.46 g/mol. Its IUPAC name is ethyl (E)-2-[3-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propyliminomethyl]but-2-enoate.
| Compound Name | ethyl (E)-2-[3-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propyliminomethyl]but-2-enoate |
|---|---|
| PubChem CID | 143872470 |
| Molecular Formula | C20H21F3N2O2S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | ethyl (E)-2-[3-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]propyliminomethyl]but-2-enoate |
| SMILES | C/C=C(\C=N\CCCc1nc(-c2cccc(C(F)(F)F)c2)cs1)C(=O)OCC |
| InChI | InChI=1S/C20H21F3N2O2S/c1-3-14(19(26)27-4-2)12-24-10-6-9-18-25-17(13-28-18)15-7-5-8-16(11-15)20(21,22)23/h3,5,7-8,11-13H,4,6,9-10H2,1-2H3/b14-3+,24-12+ |
| InChIKey | VBPMECJVZWJMBD-DSHLOAPPSA-N |
| XLogP | 5.34 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|