C14H31N3 — CID 143872809
ethane;N,N,N'-trimethyl-N'-[1-[(Z)-prop-2-enylideneamino]ethenyl]ethane-1,2-diamine (PubChem CID 143872809) has the molecular formula C14H31N3 and a molecular weight of 241.42 g/mol. Its IUPAC name is ethane;N,N,N'-trimethyl-N'-[1-[(Z)-prop-2-enylideneamino]ethenyl]ethane-1,2-diamine.
| Compound Name | ethane;N,N,N'-trimethyl-N'-[1-[(Z)-prop-2-enylideneamino]ethenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 143872809 |
| Molecular Formula | C14H31N3 |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.25 |
| IUPAC Name | ethane;N,N,N'-trimethyl-N'-[1-[(Z)-prop-2-enylideneamino]ethenyl]ethane-1,2-diamine |
| SMILES | C=C/C=N\C(=C)N(C)CCN(C)C.CC.CC |
| InChI | InChI=1S/C10H19N3.2C2H6/c1-6-7-11-10(2)13(5)9-8-12(3)4;2*1-2/h6-7H,1-2,8-9H2,3-5H3;2*1-2H3/b11-7-;; |
| InChIKey | LPDAUVTYJLEALL-FJJKMGSJSA-N |
| XLogP | 3.26 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|