C9H18N2 — CID 143017779
ethene;(Z)-1-[(Z)-ethylideneamino]-N,N-dimethylprop-1-en-1-amine (PubChem CID 143017779) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is ethene;(Z)-1-[(Z)-ethylideneamino]-N,N-dimethylprop-1-en-1-amine.
| Compound Name | ethene;(Z)-1-[(Z)-ethylideneamino]-N,N-dimethylprop-1-en-1-amine |
|---|---|
| PubChem CID | 143017779 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | ethene;(Z)-1-[(Z)-ethylideneamino]-N,N-dimethylprop-1-en-1-amine |
| SMILES | C/C=N\C(=C/C)N(C)C.C=C |
| InChI | InChI=1S/C7H14N2.C2H4/c1-5-7(8-6-2)9(3)4;1-2/h5-6H,1-4H3;1-2H2/b7-5+,8-6-; |
| InChIKey | MGKHQSSJXJEICN-LFNVCNNASA-N |
| XLogP | 2.30 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|