C11H27N3 — CID 143837560
ethane;N-methylethanimine;1-N,1-N,1-N',1-N'-tetramethylethene-1,1-diamine (PubChem CID 143837560) has the molecular formula C11H27N3 and a molecular weight of 201.36 g/mol. Its IUPAC name is ethane;N-methylethanimine;1-N,1-N,1-N',1-N'-tetramethylethene-1,1-diamine.
| Compound Name | ethane;N-methylethanimine;1-N,1-N,1-N',1-N'-tetramethylethene-1,1-diamine |
|---|---|
| PubChem CID | 143837560 |
| Molecular Formula | C11H27N3 |
| Molecular Weight | 201.36 g/mol |
| Exact Mass | 201.22 |
| IUPAC Name | ethane;N-methylethanimine;1-N,1-N,1-N',1-N'-tetramethylethene-1,1-diamine |
| SMILES | C/C=N/C.C=C(N(C)C)N(C)C.CC |
| InChI | InChI=1S/C6H14N2.C3H7N.C2H6/c1-6(7(2)3)8(4)5;1-3-4-2;1-2/h1H2,2-5H3;3H,1-2H3;1-2H3/b;4-3+; |
| InChIKey | ANFJPBPVSSMFRQ-ITDJAWRYSA-N |
| XLogP | 2.31 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|