C7H12N2+2 — CID 149354269
1-ethyl-3-methyl-2-methylideneimidazole-1,3-diium (PubChem CID 149354269) has the molecular formula C7H12N2+2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 1-ethyl-3-methyl-2-methylideneimidazole-1,3-diium.
| Compound Name | 1-ethyl-3-methyl-2-methylideneimidazole-1,3-diium |
|---|---|
| PubChem CID | 149354269 |
| Molecular Formula | C7H12N2+2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 1-ethyl-3-methyl-2-methylideneimidazole-1,3-diium |
| SMILES | C=C1[N+](C)=CC=[N+]1CC |
| InChI | InChI=1S/C7H12N2/c1-4-9-6-5-8(3)7(9)2/h5-6H,2,4H2,1,3H3/q+2 |
| InChIKey | YGPZJRXRRHDWAR-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|