C15H31N3 — CID 143872817
ethane;(Z)-N-[(1Z,3Z)-1-piperazin-1-ylpenta-1,3-dienyl]ethanimine (PubChem CID 143872817) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is ethane;(Z)-N-[(1Z,3Z)-1-piperazin-1-ylpenta-1,3-dienyl]ethanimine.
| Compound Name | ethane;(Z)-N-[(1Z,3Z)-1-piperazin-1-ylpenta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 143872817 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | ethane;(Z)-N-[(1Z,3Z)-1-piperazin-1-ylpenta-1,3-dienyl]ethanimine |
| SMILES | C/C=C\C=C(/N=C\C)N1CCNCC1.CC.CC |
| InChI | InChI=1S/C11H19N3.2C2H6/c1-3-5-6-11(13-4-2)14-9-7-12-8-10-14;2*1-2/h3-6,12H,7-10H2,1-2H3;2*1-2H3/b5-3-,11-6+,13-4-;; |
| InChIKey | RWRMKXSTUOSUIP-LFCMIVJNSA-N |
| XLogP | 3.45 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|