C10H19N3 — CID 142175146
methane;(2E)-3-piperazin-1-ylpenta-2,4-dien-1-imine (PubChem CID 142175146) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is methane;(2E)-3-piperazin-1-ylpenta-2,4-dien-1-imine.
| Compound Name | methane;(2E)-3-piperazin-1-ylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142175146 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | methane;(2E)-3-piperazin-1-ylpenta-2,4-dien-1-imine |
| SMILES | C.[H]/N=C/C=C(\C=C)N1CCNCC1 |
| InChI | InChI=1S/C9H15N3.CH4/c1-2-9(3-4-10)12-7-5-11-6-8-12;/h2-4,10-11H,1,5-8H2;1H4/b9-3+,10-4+; |
| InChIKey | XNJGBTPYCNDDDR-RUACYTINSA-N |
| XLogP | 1.25 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|