C9H16N2 — CID 91375372
1-penta-1,3-dien-3-ylpiperazine (PubChem CID 91375372) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-penta-1,3-dien-3-ylpiperazine.
| Compound Name | 1-penta-1,3-dien-3-ylpiperazine |
|---|---|
| PubChem CID | 91375372 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1-penta-1,3-dien-3-ylpiperazine |
| SMILES | C=CC(=CC)N1CCNCC1 |
| InChI | InChI=1S/C9H16N2/c1-3-9(4-2)11-7-5-10-6-8-11/h3-4,10H,1,5-8H2,2H3 |
| InChIKey | SLSYKDQDPBZURR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|