C10H16ClN3 — CID 91332538
4-(4-methylpiperazin-1-yl)penta-2,4-dienimidoyl chloride (PubChem CID 91332538) has the molecular formula C10H16ClN3 and a molecular weight of 213.71 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)penta-2,4-dienimidoyl chloride.
| Compound Name | 4-(4-methylpiperazin-1-yl)penta-2,4-dienimidoyl chloride |
|---|---|
| PubChem CID | 91332538 |
| Molecular Formula | C10H16ClN3 |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)penta-2,4-dienimidoyl chloride |
| SMILES | [H]/N=C(\Cl)C=CC(=C)N1CCN(C)CC1 |
| InChI | InChI=1S/C10H16ClN3/c1-9(3-4-10(11)12)14-7-5-13(2)6-8-14/h3-4,12H,1,5-8H2,2H3/b4-3?,12-10- |
| InChIKey | WFDLRZLULHBXRK-XEEUXSAFSA-N |
| XLogP | 1.52 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|